About 6-(4-chloro-6-propan-2-ylpyrimidin-2-yl)-1-methyl-3,4-dihydro-2H-quinoline
6-(4-chloro-6-propan-2-ylpyrimidin-2-yl)-1-methyl-3,4-dihydro-2H-quinoline (PubChem CID 62096137) has the molecular formula C17H20ClN3
and a molecular weight of 301.82 g/mol. Its IUPAC name is 6-(4-chloro-6-propan-2-ylpyrimidin-2-yl)-1-methyl-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | 6-(4-chloro-6-propan-2-ylpyrimidin-2-yl)-1-methyl-3,4-dihydro-2H-quinoline |
| PubChem CID | 62096137 |
| Molecular Formula | C17H20ClN3 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 6-(4-chloro-6-propan-2-ylpyrimidin-2-yl)-1-methyl-3,4-dihydro-2H-quinoline |
| SMILES | CC(C)c1cc(Cl)nc(-c2ccc3c(c2)CCCN3C)n1 |
| InChI | InChI=1S/C17H20ClN3/c1-11(2)14-10-16(18)20-17(19-14)13-6-7-15-12(9-13)5-4-8-21(15)3/h6-7,9-11H,4-5,8H2,1-3H3 |
| InChIKey | NPXWBFFEBRGDIM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(4-chloro-6-propan-2-ylpyrimidin-2-yl)-1-methyl-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chloro-6-propan-2-ylpyrimidin-2-yl)-1-methyl-3,4-dihydro-2H-quinoline?
The IUPAC name of 6-(4-chloro-6-propan-2-ylpyrimidin-2-yl)-1-methyl-3,4-dihydro-2H-quinoline (CID 62096137) is 6-(4-chloro-6-propan-2-ylpyrimidin-2-yl)-1-methyl-3,4-dihydro-2H-quinoline.
What is the SMILES notation for 6-(4-chloro-6-propan-2-ylpyrimidin-2-yl)-1-methyl-3,4-dihydro-2H-quinoline?
The canonical SMILES for 6-(4-chloro-6-propan-2-ylpyrimidin-2-yl)-1-methyl-3,4-dihydro-2H-quinoline is CC(C)c1cc(Cl)nc(-c2ccc3c(c2)CCCN3C)n1.
What is the InChIKey of 6-(4-chloro-6-propan-2-ylpyrimidin-2-yl)-1-methyl-3,4-dihydro-2H-quinoline?
The InChIKey is NPXWBFFEBRGDIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClN3/c1-11(2)14-10-16(18)20-17(19-14)13-6-7-15-12(9-13)5-4-8-21(15)3/h6-7,9-11H,4-5,8H2,1-3H3.
What are the key properties of 6-(4-chloro-6-propan-2-ylpyrimidin-2-yl)-1-methyl-3,4-dihydro-2H-quinoline?
6-(4-chloro-6-propan-2-ylpyrimidin-2-yl)-1-methyl-3,4-dihydro-2H-quinoline has a molecular weight of 301.82 g/mol, XLogP of 4.30, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chloro-6-propan-2-ylpyrimidin-2-yl)-1-methyl-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 62096137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).