About 1-(1,4-diazepane-1-carbonyl)cyclobutane-1-carboxylic acid
1-(1,4-diazepane-1-carbonyl)cyclobutane-1-carboxylic acid (PubChem CID 62096963) has the molecular formula C11H18N2O3
and a molecular weight of 226.28 g/mol. Its IUPAC name is 1-(1,4-diazepane-1-carbonyl)cyclobutane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-(1,4-diazepane-1-carbonyl)cyclobutane-1-carboxylic acid |
| PubChem CID | 62096963 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 1-(1,4-diazepane-1-carbonyl)cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(C(=O)N2CCCNCC2)CCC1 |
| InChI | InChI=1S/C11H18N2O3/c14-9(11(10(15)16)3-1-4-11)13-7-2-5-12-6-8-13/h12H,1-8H2,(H,15,16) |
| InChIKey | KMICWEUCODLSAU-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,4-diazepane-1-carbonyl)cyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-diazepane-1-carbonyl)cyclobutane-1-carboxylic acid?
The IUPAC name of 1-(1,4-diazepane-1-carbonyl)cyclobutane-1-carboxylic acid (CID 62096963) is 1-(1,4-diazepane-1-carbonyl)cyclobutane-1-carboxylic acid.
What is the SMILES notation for 1-(1,4-diazepane-1-carbonyl)cyclobutane-1-carboxylic acid?
The canonical SMILES for 1-(1,4-diazepane-1-carbonyl)cyclobutane-1-carboxylic acid is O=C(O)C1(C(=O)N2CCCNCC2)CCC1.
What is the InChIKey of 1-(1,4-diazepane-1-carbonyl)cyclobutane-1-carboxylic acid?
The InChIKey is KMICWEUCODLSAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3/c14-9(11(10(15)16)3-1-4-11)13-7-2-5-12-6-8-13/h12H,1-8H2,(H,15,16).
What are the key properties of 1-(1,4-diazepane-1-carbonyl)cyclobutane-1-carboxylic acid?
1-(1,4-diazepane-1-carbonyl)cyclobutane-1-carboxylic acid has a molecular weight of 226.28 g/mol, XLogP of 0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-diazepane-1-carbonyl)cyclobutane-1-carboxylic acid is sourced from PubChem (CID 62096963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).