C13H6Cl2FNO4 — CID 62098122
4-(2,6-dichloro-4-nitrophenoxy)-3-fluorobenzaldehyde (PubChem CID 62098122) has the molecular formula C13H6Cl2FNO4 and a molecular weight of 330.10 g/mol. Its IUPAC name is 4-(2,6-dichloro-4-nitrophenoxy)-3-fluorobenzaldehyde.
| Compound Name | 4-(2,6-dichloro-4-nitrophenoxy)-3-fluorobenzaldehyde |
|---|---|
| PubChem CID | 62098122 |
| Molecular Formula | C13H6Cl2FNO4 |
| Molecular Weight | 330.10 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | 4-(2,6-dichloro-4-nitrophenoxy)-3-fluorobenzaldehyde |
| SMILES | O=Cc1ccc(Oc2c(Cl)cc([N+](=O)[O-])cc2Cl)c(F)c1 |
| InChI | InChI=1S/C13H6Cl2FNO4/c14-9-4-8(17(19)20)5-10(15)13(9)21-12-2-1-7(6-18)3-11(12)16/h1-6H |
| InChIKey | MYLWZJSPYKZOKE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.10 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|