C15H15N5 — CID 62098270
4,5-dimethyl-2-(5-phenyltetrazol-1-yl)aniline (PubChem CID 62098270) has the molecular formula C15H15N5 and a molecular weight of 265.32 g/mol. Its IUPAC name is 4,5-dimethyl-2-(5-phenyltetrazol-1-yl)aniline.
| Compound Name | 4,5-dimethyl-2-(5-phenyltetrazol-1-yl)aniline |
|---|---|
| PubChem CID | 62098270 |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 4,5-dimethyl-2-(5-phenyltetrazol-1-yl)aniline |
| SMILES | Cc1cc(N)c(-n2nnnc2-c2ccccc2)cc1C |
| InChI | InChI=1S/C15H15N5/c1-10-8-13(16)14(9-11(10)2)20-15(17-18-19-20)12-6-4-3-5-7-12/h3-9H,16H2,1-2H3 |
| InChIKey | FSJBJSBAURSPEE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|