About N-amino-N'-cyclopropyl-2-methoxy-2-phenylethanimidamide
N-amino-N'-cyclopropyl-2-methoxy-2-phenylethanimidamide (PubChem CID 62099773) has the molecular formula C12H17N3O
and a molecular weight of 219.29 g/mol. Its IUPAC name is N-amino-N'-cyclopropyl-2-methoxy-2-phenylethanimidamide.
Molecular Properties
| Compound Name | N-amino-N'-cyclopropyl-2-methoxy-2-phenylethanimidamide |
| PubChem CID | 62099773 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | N-amino-N'-cyclopropyl-2-methoxy-2-phenylethanimidamide |
| SMILES | COC(/C(=N/C1CC1)NN)c1ccccc1 |
| InChI | InChI=1S/C12H17N3O/c1-16-11(9-5-3-2-4-6-9)12(15-13)14-10-7-8-10/h2-6,10-11H,7-8,13H2,1H3,(H,14,15) |
| InChIKey | GCDDQJNPWLGJNB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-N'-cyclopropyl-2-methoxy-2-phenylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-N'-cyclopropyl-2-methoxy-2-phenylethanimidamide?
The IUPAC name of N-amino-N'-cyclopropyl-2-methoxy-2-phenylethanimidamide (CID 62099773) is N-amino-N'-cyclopropyl-2-methoxy-2-phenylethanimidamide.
What is the SMILES notation for N-amino-N'-cyclopropyl-2-methoxy-2-phenylethanimidamide?
The canonical SMILES for N-amino-N'-cyclopropyl-2-methoxy-2-phenylethanimidamide is COC(/C(=N/C1CC1)NN)c1ccccc1.
What is the InChIKey of N-amino-N'-cyclopropyl-2-methoxy-2-phenylethanimidamide?
The InChIKey is GCDDQJNPWLGJNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O/c1-16-11(9-5-3-2-4-6-9)12(15-13)14-10-7-8-10/h2-6,10-11H,7-8,13H2,1H3,(H,14,15).
What are the key properties of N-amino-N'-cyclopropyl-2-methoxy-2-phenylethanimidamide?
N-amino-N'-cyclopropyl-2-methoxy-2-phenylethanimidamide has a molecular weight of 219.29 g/mol, XLogP of 1.40, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-N'-cyclopropyl-2-methoxy-2-phenylethanimidamide is sourced from PubChem (CID 62099773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).