C10H13F3N2O2 — CID 62100972
3-amino-1-[3-(2,2,2-trifluoroethoxy)propyl]pyridin-2-one (PubChem CID 62100972) has the molecular formula C10H13F3N2O2 and a molecular weight of 250.22 g/mol. Its IUPAC name is 3-amino-1-[3-(2,2,2-trifluoroethoxy)propyl]pyridin-2-one.
| Compound Name | 3-amino-1-[3-(2,2,2-trifluoroethoxy)propyl]pyridin-2-one |
|---|---|
| PubChem CID | 62100972 |
| Molecular Formula | C10H13F3N2O2 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 3-amino-1-[3-(2,2,2-trifluoroethoxy)propyl]pyridin-2-one |
| SMILES | Nc1cccn(CCCOCC(F)(F)F)c1=O |
| InChI | InChI=1S/C10H13F3N2O2/c11-10(12,13)7-17-6-2-5-15-4-1-3-8(14)9(15)16/h1,3-4H,2,5-7,14H2 |
| InChIKey | WLBLWPVFDFVLEK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|