About 5-chloro-2-(1,3-thiazol-2-ylsulfanylmethyl)aniline
5-chloro-2-(1,3-thiazol-2-ylsulfanylmethyl)aniline (PubChem CID 62101108) has the molecular formula C10H9ClN2S2
and a molecular weight of 256.78 g/mol. Its IUPAC name is 5-chloro-2-(1,3-thiazol-2-ylsulfanylmethyl)aniline.
Molecular Properties
| Compound Name | 5-chloro-2-(1,3-thiazol-2-ylsulfanylmethyl)aniline |
| PubChem CID | 62101108 |
| Molecular Formula | C10H9ClN2S2 |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | 5-chloro-2-(1,3-thiazol-2-ylsulfanylmethyl)aniline |
| SMILES | Nc1cc(Cl)ccc1CSc1nccs1 |
| InChI | InChI=1S/C10H9ClN2S2/c11-8-2-1-7(9(12)5-8)6-15-10-13-3-4-14-10/h1-5H,6,12H2 |
| InChIKey | GQBPLKXNABYHAT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-(1,3-thiazol-2-ylsulfanylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(1,3-thiazol-2-ylsulfanylmethyl)aniline?
The IUPAC name of 5-chloro-2-(1,3-thiazol-2-ylsulfanylmethyl)aniline (CID 62101108) is 5-chloro-2-(1,3-thiazol-2-ylsulfanylmethyl)aniline.
What is the SMILES notation for 5-chloro-2-(1,3-thiazol-2-ylsulfanylmethyl)aniline?
The canonical SMILES for 5-chloro-2-(1,3-thiazol-2-ylsulfanylmethyl)aniline is Nc1cc(Cl)ccc1CSc1nccs1.
What is the InChIKey of 5-chloro-2-(1,3-thiazol-2-ylsulfanylmethyl)aniline?
The InChIKey is GQBPLKXNABYHAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN2S2/c11-8-2-1-7(9(12)5-8)6-15-10-13-3-4-14-10/h1-5H,6,12H2.
What are the key properties of 5-chloro-2-(1,3-thiazol-2-ylsulfanylmethyl)aniline?
5-chloro-2-(1,3-thiazol-2-ylsulfanylmethyl)aniline has a molecular weight of 256.78 g/mol, XLogP of 3.67, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(1,3-thiazol-2-ylsulfanylmethyl)aniline is sourced from PubChem (CID 62101108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).