C15H17ClN4S — CID 62101926
5-chloro-2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanylmethyl]aniline (PubChem CID 62101926) has the molecular formula C15H17ClN4S and a molecular weight of 320.85 g/mol. Its IUPAC name is 5-chloro-2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanylmethyl]aniline.
| Compound Name | 5-chloro-2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanylmethyl]aniline |
|---|---|
| PubChem CID | 62101926 |
| Molecular Formula | C15H17ClN4S |
| Molecular Weight | 320.85 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 5-chloro-2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanylmethyl]aniline |
| SMILES | Nc1cc(Cl)ccc1CSc1nnc(C2CC2)n1C1CC1 |
| InChI | InChI=1S/C15H17ClN4S/c16-11-4-3-10(13(17)7-11)8-21-15-19-18-14(9-1-2-9)20(15)12-5-6-12/h3-4,7,9,12H,1-2,5-6,8,17H2 |
| InChIKey | NJDDVWWXUYEZLZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.85 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|