C12H17N3O2 — CID 62104147
N-[5-[(Z)-N'-hydroxycarbamimidoyl]-2-methylphenyl]butanamide (PubChem CID 62104147) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is N-[5-[(Z)-N'-hydroxycarbamimidoyl]-2-methylphenyl]butanamide.
| Compound Name | N-[5-[(Z)-N'-hydroxycarbamimidoyl]-2-methylphenyl]butanamide |
|---|---|
| PubChem CID | 62104147 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | N-[5-[(Z)-N'-hydroxycarbamimidoyl]-2-methylphenyl]butanamide |
| SMILES | CCCC(=O)Nc1cc(/C(N)=N/O)ccc1C |
| InChI | InChI=1S/C12H17N3O2/c1-3-4-11(16)14-10-7-9(12(13)15-17)6-5-8(10)2/h5-7,17H,3-4H2,1-2H3,(H2,13,15)(H,14,16) |
| InChIKey | RKUQLHPEBBPDLH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|