C16H24ClNO2 — CID 62106804
N-[2-(2-chlorophenyl)-2-(oxan-4-yloxy)ethyl]propan-1-amine (PubChem CID 62106804) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-(oxan-4-yloxy)ethyl]propan-1-amine.
| Compound Name | N-[2-(2-chlorophenyl)-2-(oxan-4-yloxy)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 62106804 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-(oxan-4-yloxy)ethyl]propan-1-amine |
| SMILES | CCCNCC(OC1CCOCC1)c1ccccc1Cl |
| InChI | InChI=1S/C16H24ClNO2/c1-2-9-18-12-16(14-5-3-4-6-15(14)17)20-13-7-10-19-11-8-13/h3-6,13,16,18H,2,7-12H2,1H3 |
| InChIKey | DPQYBTLEQSMSJS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|