C38H40N6O5 — CID 6210798
3-[2-[(7E)-3-(4-ethoxyphenyl)-7-[(4-ethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-5-(4-ethylphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione (PubChem CID 6210798) has the molecular formula C38H40N6O5 and a molecular weight of 660.77 g/mol. Its IUPAC name is 3-[2-[(7E)-3-(4-ethoxyphenyl)-7-[(4-ethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-5-(4-ethylphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione.
| Compound Name | 3-[2-[(7E)-3-(4-ethoxyphenyl)-7-[(4-ethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-5-(4-ethylphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 6210798 |
| Molecular Formula | C38H40N6O5 |
| Molecular Weight | 660.77 g/mol |
| Exact Mass | 660.31 |
| IUPAC Name | 3-[2-[(7E)-3-(4-ethoxyphenyl)-7-[(4-ethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-5-(4-ethylphenyl)-3a,6a-dihydropyrrolo[3,4-d]triazole-4,6-dione |
| SMILES | CCOc1ccc(/C=C2\CCCC3C2=NN(C(=O)CN2N=NC4C(=O)N(c5ccc(CC)cc5)C(=O)C42)C3c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C38H40N6O5/c1-4-24-10-16-28(17-11-24)43-37(46)34-36(38(43)47)42(41-39-34)23-32(45)44-35(26-14-20-30(21-15-26)49-6-3)31-9-7-8-27(33(31)40-44)22-25-12-18-29(19-13-25)48-5-2/h10-22,31,34-36H,4-9,23H2,1-3H3/b27-22+ |
| InChIKey | NUJNPRJBKCIGMP-HPNDGRJYSA-N |
| XLogP | 6.16 |
| TPSA | 116.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.77 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|