C13H21NO — CID 62108356
N-[2-methoxy-2-(2-methylphenyl)ethyl]propan-2-amine (PubChem CID 62108356) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is N-[2-methoxy-2-(2-methylphenyl)ethyl]propan-2-amine.
| Compound Name | N-[2-methoxy-2-(2-methylphenyl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 62108356 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | N-[2-methoxy-2-(2-methylphenyl)ethyl]propan-2-amine |
| SMILES | COC(CNC(C)C)c1ccccc1C |
| InChI | InChI=1S/C13H21NO/c1-10(2)14-9-13(15-4)12-8-6-5-7-11(12)3/h5-8,10,13-14H,9H2,1-4H3 |
| InChIKey | BQQAKXRGOQKTEO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |