About bis(2-butylquinolin-8-ol);cobalt
bis(2-butylquinolin-8-ol);cobalt (PubChem CID 621097) has the molecular formula C26H30CoN2O2
and a molecular weight of 461.47 g/mol. Its IUPAC name is bis(2-butylquinolin-8-ol);cobalt.
Molecular Properties
| Compound Name | bis(2-butylquinolin-8-ol);cobalt |
| PubChem CID | 621097 |
| Molecular Formula | C26H30CoN2O2 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | bis(2-butylquinolin-8-ol);cobalt |
| SMILES | CCCCc1ccc2cccc(O)c2n1.CCCCc1ccc2cccc(O)c2n1.[Co] |
| InChI | InChI=1S/2C13H15NO.Co/c2*1-2-3-6-11-9-8-10-5-4-7-12(15)13(10)14-11;/h2*4-5,7-9,15H,2-3,6H2,1H3; |
| InChIKey | VHCAZNKYOYJUJI-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(2-butylquinolin-8-ol);cobalt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-butylquinolin-8-ol);cobalt?
The IUPAC name of bis(2-butylquinolin-8-ol);cobalt (CID 621097) is bis(2-butylquinolin-8-ol);cobalt.
What is the SMILES notation for bis(2-butylquinolin-8-ol);cobalt?
The canonical SMILES for bis(2-butylquinolin-8-ol);cobalt is CCCCc1ccc2cccc(O)c2n1.CCCCc1ccc2cccc(O)c2n1.[Co].
What is the InChIKey of bis(2-butylquinolin-8-ol);cobalt?
The InChIKey is VHCAZNKYOYJUJI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H15NO.Co/c2*1-2-3-6-11-9-8-10-5-4-7-12(15)13(10)14-11;/h2*4-5,7-9,15H,2-3,6H2,1H3;.
What are the key properties of bis(2-butylquinolin-8-ol);cobalt?
bis(2-butylquinolin-8-ol);cobalt has a molecular weight of 461.47 g/mol, XLogP of 6.56, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-butylquinolin-8-ol);cobalt is sourced from PubChem (CID 621097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).