C10H8F10N2O2 — CID 621115
2,2,3,3,3-pentafluoro-1-[4-(2,2,3,3,3-pentafluoropropanoyl)piperazin-1-yl]propan-1-one (PubChem CID 621115) has the molecular formula C10H8F10N2O2 and a molecular weight of 378.17 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-[4-(2,2,3,3,3-pentafluoropropanoyl)piperazin-1-yl]propan-1-one.
| Compound Name | 2,2,3,3,3-pentafluoro-1-[4-(2,2,3,3,3-pentafluoropropanoyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 621115 |
| Molecular Formula | C10H8F10N2O2 |
| Molecular Weight | 378.17 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-[4-(2,2,3,3,3-pentafluoropropanoyl)piperazin-1-yl]propan-1-one |
| SMILES | O=C(N1CCN(C(=O)C(F)(F)C(F)(F)F)CC1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H8F10N2O2/c11-7(12,9(15,16)17)5(23)21-1-2-22(4-3-21)6(24)8(13,14)10(18,19)20/h1-4H2 |
| InChIKey | WQTVMEARTKHBJT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.17 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|