About 3-(3,4-difluorophenyl)-1H-pyrazole-5-carbaldehyde
3-(3,4-difluorophenyl)-1H-pyrazole-5-carbaldehyde (PubChem CID 62111842) has the molecular formula C10H6F2N2O
and a molecular weight of 208.17 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-1H-pyrazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 3-(3,4-difluorophenyl)-1H-pyrazole-5-carbaldehyde |
| PubChem CID | 62111842 |
| Molecular Formula | C10H6F2N2O |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 3-(3,4-difluorophenyl)-1H-pyrazole-5-carbaldehyde |
| SMILES | O=Cc1cc(-c2ccc(F)c(F)c2)n[nH]1 |
| InChI | InChI=1S/C10H6F2N2O/c11-8-2-1-6(3-9(8)12)10-4-7(5-15)13-14-10/h1-5H,(H,13,14) |
| InChIKey | OUXIMFRKIBMKQI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-difluorophenyl)-1H-pyrazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-difluorophenyl)-1H-pyrazole-5-carbaldehyde?
The IUPAC name of 3-(3,4-difluorophenyl)-1H-pyrazole-5-carbaldehyde (CID 62111842) is 3-(3,4-difluorophenyl)-1H-pyrazole-5-carbaldehyde.
What is the SMILES notation for 3-(3,4-difluorophenyl)-1H-pyrazole-5-carbaldehyde?
The canonical SMILES for 3-(3,4-difluorophenyl)-1H-pyrazole-5-carbaldehyde is O=Cc1cc(-c2ccc(F)c(F)c2)n[nH]1.
What is the InChIKey of 3-(3,4-difluorophenyl)-1H-pyrazole-5-carbaldehyde?
The InChIKey is OUXIMFRKIBMKQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F2N2O/c11-8-2-1-6(3-9(8)12)10-4-7(5-15)13-14-10/h1-5H,(H,13,14).
What are the key properties of 3-(3,4-difluorophenyl)-1H-pyrazole-5-carbaldehyde?
3-(3,4-difluorophenyl)-1H-pyrazole-5-carbaldehyde has a molecular weight of 208.17 g/mol, XLogP of 2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-difluorophenyl)-1H-pyrazole-5-carbaldehyde is sourced from PubChem (CID 62111842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).