About bis(trimethylsilyl) 2,2-dipropylpropanedioate
bis(trimethylsilyl) 2,2-dipropylpropanedioate (PubChem CID 621125) has the molecular formula C15H32O4Si2
and a molecular weight of 332.59 g/mol. Its IUPAC name is bis(trimethylsilyl) 2,2-dipropylpropanedioate.
Molecular Properties
| Compound Name | bis(trimethylsilyl) 2,2-dipropylpropanedioate |
| PubChem CID | 621125 |
| Molecular Formula | C15H32O4Si2 |
| Molecular Weight | 332.59 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | bis(trimethylsilyl) 2,2-dipropylpropanedioate |
| SMILES | CCCC(CCC)(C(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C15H32O4Si2/c1-9-11-15(12-10-2,13(16)18-20(3,4)5)14(17)19-21(6,7)8/h9-12H2,1-8H3 |
| InChIKey | DWLIUIJNJMCHOA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(trimethylsilyl) 2,2-dipropylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trimethylsilyl) 2,2-dipropylpropanedioate?
The IUPAC name of bis(trimethylsilyl) 2,2-dipropylpropanedioate (CID 621125) is bis(trimethylsilyl) 2,2-dipropylpropanedioate.
What is the SMILES notation for bis(trimethylsilyl) 2,2-dipropylpropanedioate?
The canonical SMILES for bis(trimethylsilyl) 2,2-dipropylpropanedioate is CCCC(CCC)(C(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C.
What is the InChIKey of bis(trimethylsilyl) 2,2-dipropylpropanedioate?
The InChIKey is DWLIUIJNJMCHOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32O4Si2/c1-9-11-15(12-10-2,13(16)18-20(3,4)5)14(17)19-21(6,7)8/h9-12H2,1-8H3.
What are the key properties of bis(trimethylsilyl) 2,2-dipropylpropanedioate?
bis(trimethylsilyl) 2,2-dipropylpropanedioate has a molecular weight of 332.59 g/mol, XLogP of 4.33, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trimethylsilyl) 2,2-dipropylpropanedioate is sourced from PubChem (CID 621125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).