About 3-phenyl-1,2-benzoselenazole
3-phenyl-1,2-benzoselenazole (PubChem CID 621129) has the molecular formula C13H9NSe
and a molecular weight of 258.18 g/mol. Its IUPAC name is 3-phenyl-1,2-benzoselenazole.
Molecular Properties
| Compound Name | 3-phenyl-1,2-benzoselenazole |
| PubChem CID | 621129 |
| Molecular Formula | C13H9NSe |
| Molecular Weight | 258.18 g/mol |
| Exact Mass | 258.99 |
| IUPAC Name | 3-phenyl-1,2-benzoselenazole |
| SMILES | c1ccc(-c2n[se]c3ccccc23)cc1 |
| InChI | InChI=1S/C13H9NSe/c1-2-6-10(7-3-1)13-11-8-4-5-9-12(11)15-14-13/h1-9H |
| InChIKey | MZRMSPMYJJSKEH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.18 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-1,2-benzoselenazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-1,2-benzoselenazole?
The IUPAC name of 3-phenyl-1,2-benzoselenazole (CID 621129) is 3-phenyl-1,2-benzoselenazole.
What is the SMILES notation for 3-phenyl-1,2-benzoselenazole?
The canonical SMILES for 3-phenyl-1,2-benzoselenazole is c1ccc(-c2n[se]c3ccccc23)cc1.
What is the InChIKey of 3-phenyl-1,2-benzoselenazole?
The InChIKey is MZRMSPMYJJSKEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NSe/c1-2-6-10(7-3-1)13-11-8-4-5-9-12(11)15-14-13/h1-9H.
What are the key properties of 3-phenyl-1,2-benzoselenazole?
3-phenyl-1,2-benzoselenazole has a molecular weight of 258.18 g/mol, XLogP of 2.96, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1,2-benzoselenazole is sourced from PubChem (CID 621129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).