C13H17ClN2O5 — CID 62113975
2-amino-6-(3-chloro-4-nitrophenoxy)-2-methylhexanoic acid (PubChem CID 62113975) has the molecular formula C13H17ClN2O5 and a molecular weight of 316.74 g/mol. Its IUPAC name is 2-amino-6-(3-chloro-4-nitrophenoxy)-2-methylhexanoic acid.
| Compound Name | 2-amino-6-(3-chloro-4-nitrophenoxy)-2-methylhexanoic acid |
|---|---|
| PubChem CID | 62113975 |
| Molecular Formula | C13H17ClN2O5 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 2-amino-6-(3-chloro-4-nitrophenoxy)-2-methylhexanoic acid |
| SMILES | CC(N)(CCCCOc1ccc([N+](=O)[O-])c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C13H17ClN2O5/c1-13(15,12(17)18)6-2-3-7-21-9-4-5-11(16(19)20)10(14)8-9/h4-5,8H,2-3,6-7,15H2,1H3,(H,17,18) |
| InChIKey | RHWPOQCEQBOSPA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|