C13H12FN3O3S — CID 62113980
3-[(3-amino-4-pyridinyl)sulfonylmethyl]-4-fluorobenzamide (PubChem CID 62113980) has the molecular formula C13H12FN3O3S and a molecular weight of 309.32 g/mol. Its IUPAC name is 3-[(3-amino-4-pyridinyl)sulfonylmethyl]-4-fluorobenzamide.
| Compound Name | 3-[(3-amino-4-pyridinyl)sulfonylmethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 62113980 |
| Molecular Formula | C13H12FN3O3S |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 3-[(3-amino-4-pyridinyl)sulfonylmethyl]-4-fluorobenzamide |
| SMILES | NC(=O)c1ccc(F)c(CS(=O)(=O)c2ccncc2N)c1 |
| InChI | InChI=1S/C13H12FN3O3S/c14-10-2-1-8(13(16)18)5-9(10)7-21(19,20)12-3-4-17-6-11(12)15/h1-6H,7,15H2,(H2,16,18) |
| InChIKey | UCSRCWOBWUDIBF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |