C13H18N4O4 — CID 62115331
1-[2-[5-(methylaminomethyl)-2-nitrophenoxy]ethyl]imidazolidin-2-one (PubChem CID 62115331) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is 1-[2-[5-(methylaminomethyl)-2-nitrophenoxy]ethyl]imidazolidin-2-one.
| Compound Name | 1-[2-[5-(methylaminomethyl)-2-nitrophenoxy]ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 62115331 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 1-[2-[5-(methylaminomethyl)-2-nitrophenoxy]ethyl]imidazolidin-2-one |
| SMILES | CNCc1ccc([N+](=O)[O-])c(OCCN2CCNC2=O)c1 |
| InChI | InChI=1S/C13H18N4O4/c1-14-9-10-2-3-11(17(19)20)12(8-10)21-7-6-16-5-4-15-13(16)18/h2-3,8,14H,4-7,9H2,1H3,(H,15,18) |
| InChIKey | JLAPFYKKSCDHPX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|