About 4-cyclobutyloxy-3,5-difluoroaniline
4-cyclobutyloxy-3,5-difluoroaniline (PubChem CID 62115960) has the molecular formula C10H11F2NO
and a molecular weight of 199.20 g/mol. Its IUPAC name is 4-cyclobutyloxy-3,5-difluoroaniline.
Molecular Properties
| Compound Name | 4-cyclobutyloxy-3,5-difluoroaniline |
| PubChem CID | 62115960 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 4-cyclobutyloxy-3,5-difluoroaniline |
| SMILES | Nc1cc(F)c(OC2CCC2)c(F)c1 |
| InChI | InChI=1S/C10H11F2NO/c11-8-4-6(13)5-9(12)10(8)14-7-2-1-3-7/h4-5,7H,1-3,13H2 |
| InChIKey | DCWFFDXIFUAFQJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclobutyloxy-3,5-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclobutyloxy-3,5-difluoroaniline?
The IUPAC name of 4-cyclobutyloxy-3,5-difluoroaniline (CID 62115960) is 4-cyclobutyloxy-3,5-difluoroaniline.
What is the SMILES notation for 4-cyclobutyloxy-3,5-difluoroaniline?
The canonical SMILES for 4-cyclobutyloxy-3,5-difluoroaniline is Nc1cc(F)c(OC2CCC2)c(F)c1.
What is the InChIKey of 4-cyclobutyloxy-3,5-difluoroaniline?
The InChIKey is DCWFFDXIFUAFQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NO/c11-8-4-6(13)5-9(12)10(8)14-7-2-1-3-7/h4-5,7H,1-3,13H2.
What are the key properties of 4-cyclobutyloxy-3,5-difluoroaniline?
4-cyclobutyloxy-3,5-difluoroaniline has a molecular weight of 199.20 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclobutyloxy-3,5-difluoroaniline is sourced from PubChem (CID 62115960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).