About 5-cyclobutyloxy-1,3-dimethylpyrazol-4-amine
5-cyclobutyloxy-1,3-dimethylpyrazol-4-amine (PubChem CID 62116290) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 5-cyclobutyloxy-1,3-dimethylpyrazol-4-amine.
Molecular Properties
| Compound Name | 5-cyclobutyloxy-1,3-dimethylpyrazol-4-amine |
| PubChem CID | 62116290 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 5-cyclobutyloxy-1,3-dimethylpyrazol-4-amine |
| SMILES | Cc1nn(C)c(OC2CCC2)c1N |
| InChI | InChI=1S/C9H15N3O/c1-6-8(10)9(12(2)11-6)13-7-4-3-5-7/h7H,3-5,10H2,1-2H3 |
| InChIKey | VCHAFFFKPCSBII-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-cyclobutyloxy-1,3-dimethylpyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclobutyloxy-1,3-dimethylpyrazol-4-amine?
The IUPAC name of 5-cyclobutyloxy-1,3-dimethylpyrazol-4-amine (CID 62116290) is 5-cyclobutyloxy-1,3-dimethylpyrazol-4-amine.
What is the SMILES notation for 5-cyclobutyloxy-1,3-dimethylpyrazol-4-amine?
The canonical SMILES for 5-cyclobutyloxy-1,3-dimethylpyrazol-4-amine is Cc1nn(C)c(OC2CCC2)c1N.
What is the InChIKey of 5-cyclobutyloxy-1,3-dimethylpyrazol-4-amine?
The InChIKey is VCHAFFFKPCSBII-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-6-8(10)9(12(2)11-6)13-7-4-3-5-7/h7H,3-5,10H2,1-2H3.
What are the key properties of 5-cyclobutyloxy-1,3-dimethylpyrazol-4-amine?
5-cyclobutyloxy-1,3-dimethylpyrazol-4-amine has a molecular weight of 181.24 g/mol, XLogP of 1.24, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclobutyloxy-1,3-dimethylpyrazol-4-amine is sourced from PubChem (CID 62116290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).