C11H13F3N2O4 — CID 62116368
[4-nitro-3-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]methanamine (PubChem CID 62116368) has the molecular formula C11H13F3N2O4 and a molecular weight of 294.23 g/mol. Its IUPAC name is [4-nitro-3-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]methanamine.
| Compound Name | [4-nitro-3-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 62116368 |
| Molecular Formula | C11H13F3N2O4 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | [4-nitro-3-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]methanamine |
| SMILES | NCc1ccc([N+](=O)[O-])c(OCCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3N2O4/c12-11(13,14)7-19-3-4-20-10-5-8(6-15)1-2-9(10)16(17)18/h1-2,5H,3-4,6-7,15H2 |
| InChIKey | KHFBHIPZKYWQFP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|