C7H10N6S — CID 62117003
4-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1H-1,2,4-triazole-5-thione (PubChem CID 62117003) has the molecular formula C7H10N6S and a molecular weight of 210.27 g/mol. Its IUPAC name is 4-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 62117003 |
| Molecular Formula | C7H10N6S |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 4-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1H-1,2,4-triazole-5-thione |
| SMILES | CC(c1nncn1C)n1cn[nH]c1=S |
| InChI | InChI=1S/C7H10N6S/c1-5(6-10-8-3-12(6)2)13-4-9-11-7(13)14/h3-5H,1-2H3,(H,11,14) |
| InChIKey | PDPUAZXGEMYSLQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|