About 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]acetic acid
2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]acetic acid (PubChem CID 62117345) has the molecular formula C7H12N4O2
and a molecular weight of 184.20 g/mol. Its IUPAC name is 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]acetic acid.
Molecular Properties
| Compound Name | 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]acetic acid |
| PubChem CID | 62117345 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]acetic acid |
| SMILES | CC(NCC(=O)O)c1nncn1C |
| InChI | InChI=1S/C7H12N4O2/c1-5(8-3-6(12)13)7-10-9-4-11(7)2/h4-5,8H,3H2,1-2H3,(H,12,13) |
| InChIKey | DRLZODKZZFKHSI-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]acetic acid?
The IUPAC name of 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]acetic acid (CID 62117345) is 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]acetic acid.
What is the SMILES notation for 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]acetic acid?
The canonical SMILES for 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]acetic acid is CC(NCC(=O)O)c1nncn1C.
What is the InChIKey of 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]acetic acid?
The InChIKey is DRLZODKZZFKHSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O2/c1-5(8-3-6(12)13)7-10-9-4-11(7)2/h4-5,8H,3H2,1-2H3,(H,12,13).
What are the key properties of 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]acetic acid?
2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]acetic acid has a molecular weight of 184.20 g/mol, XLogP of -0.45, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]acetic acid is sourced from PubChem (CID 62117345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).