C9H14N6S — CID 62117370
4-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-propyl-1H-1,2,4-triazole-5-thione (PubChem CID 62117370) has the molecular formula C9H14N6S and a molecular weight of 238.32 g/mol. Its IUPAC name is 4-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-propyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-propyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 62117370 |
| Molecular Formula | C9H14N6S |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 4-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-propyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCc1n[nH]c(=S)n1Cc1nncn1C |
| InChI | InChI=1S/C9H14N6S/c1-3-4-7-12-13-9(16)15(7)5-8-11-10-6-14(8)2/h6H,3-5H2,1-2H3,(H,13,16) |
| InChIKey | TWQJAYXGGPUIFK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|