C9H12N6S — CID 62117372
3-cyclopropyl-4-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 62117372) has the molecular formula C9H12N6S and a molecular weight of 236.30 g/mol. Its IUPAC name is 3-cyclopropyl-4-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-cyclopropyl-4-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 62117372 |
| Molecular Formula | C9H12N6S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3-cyclopropyl-4-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Cn1cnnc1Cn1c(C2CC2)n[nH]c1=S |
| InChI | InChI=1S/C9H12N6S/c1-14-5-10-11-7(14)4-15-8(6-2-3-6)12-13-9(15)16/h5-6H,2-4H2,1H3,(H,13,16) |
| InChIKey | YRWJQQURRPOJLB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|