About 1-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butan-2-ol
1-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butan-2-ol (PubChem CID 62117692) has the molecular formula C8H16N4O
and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butan-2-ol.
Molecular Properties
| Compound Name | 1-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butan-2-ol |
| PubChem CID | 62117692 |
| Molecular Formula | C8H16N4O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 1-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butan-2-ol |
| SMILES | CCC(O)CNCc1nncn1C |
| InChI | InChI=1S/C8H16N4O/c1-3-7(13)4-9-5-8-11-10-6-12(8)2/h6-7,9,13H,3-5H2,1-2H3 |
| InChIKey | MIMVVWWZEBAUFW-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butan-2-ol?
The IUPAC name of 1-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butan-2-ol (CID 62117692) is 1-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butan-2-ol.
What is the SMILES notation for 1-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butan-2-ol?
The canonical SMILES for 1-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butan-2-ol is CCC(O)CNCc1nncn1C.
What is the InChIKey of 1-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butan-2-ol?
The InChIKey is MIMVVWWZEBAUFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4O/c1-3-7(13)4-9-5-8-11-10-6-12(8)2/h6-7,9,13H,3-5H2,1-2H3.
What are the key properties of 1-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butan-2-ol?
1-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butan-2-ol has a molecular weight of 184.24 g/mol, XLogP of -0.32, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-methyl-1,2,4-triazol-3-yl)methylamino]butan-2-ol is sourced from PubChem (CID 62117692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).