C12H26N2O — CID 62117829
N,N-diethyl-2-(hexan-3-ylamino)acetamide (PubChem CID 62117829) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is N,N-diethyl-2-(hexan-3-ylamino)acetamide.
| Compound Name | N,N-diethyl-2-(hexan-3-ylamino)acetamide |
|---|---|
| PubChem CID | 62117829 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | N,N-diethyl-2-(hexan-3-ylamino)acetamide |
| SMILES | CCCC(CC)NCC(=O)N(CC)CC |
| InChI | InChI=1S/C12H26N2O/c1-5-9-11(6-2)13-10-12(15)14(7-3)8-4/h11,13H,5-10H2,1-4H3 |
| InChIKey | NJCQOUMTWXHRFF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |