About 2-cyano-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide
2-cyano-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide (PubChem CID 62118666) has the molecular formula C10H15N5O
and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-cyano-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide.
Molecular Properties
| Compound Name | 2-cyano-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide |
| PubChem CID | 62118666 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 2-cyano-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide |
| SMILES | CCCC(C#N)C(=O)NCc1nncn1C |
| InChI | InChI=1S/C10H15N5O/c1-3-4-8(5-11)10(16)12-6-9-14-13-7-15(9)2/h7-8H,3-4,6H2,1-2H3,(H,12,16) |
| InChIKey | UXQLPXKZIUCCSK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyano-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide?
The IUPAC name of 2-cyano-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide (CID 62118666) is 2-cyano-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide.
What is the SMILES notation for 2-cyano-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide?
The canonical SMILES for 2-cyano-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide is CCCC(C#N)C(=O)NCc1nncn1C.
What is the InChIKey of 2-cyano-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide?
The InChIKey is UXQLPXKZIUCCSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5O/c1-3-4-8(5-11)10(16)12-6-9-14-13-7-15(9)2/h7-8H,3-4,6H2,1-2H3,(H,12,16).
What are the key properties of 2-cyano-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide?
2-cyano-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide has a molecular weight of 221.26 g/mol, XLogP of 0.37, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pentanamide is sourced from PubChem (CID 62118666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).