C12H14F3N5 — CID 62118811
1-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 62118811) has the molecular formula C12H14F3N5 and a molecular weight of 285.27 g/mol. Its IUPAC name is 1-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 1-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 62118811 |
| Molecular Formula | C12H14F3N5 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1-N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | CC(Nc1ccc(N)cc1C(F)(F)F)c1nncn1C |
| InChI | InChI=1S/C12H14F3N5/c1-7(11-19-17-6-20(11)2)18-10-4-3-8(16)5-9(10)12(13,14)15/h3-7,18H,16H2,1-2H3 |
| InChIKey | WHEOHIRKJMXYEQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|