C8H9N5O3 — CID 62118876
1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]imidazolidine-2,4,5-trione (PubChem CID 62118876) has the molecular formula C8H9N5O3 and a molecular weight of 223.19 g/mol. Its IUPAC name is 1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 62118876 |
| Molecular Formula | C8H9N5O3 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 1-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]imidazolidine-2,4,5-trione |
| SMILES | CC(c1nncn1C)N1C(=O)NC(=O)C1=O |
| InChI | InChI=1S/C8H9N5O3/c1-4(5-11-9-3-12(5)2)13-7(15)6(14)10-8(13)16/h3-4H,1-2H3,(H,10,14,16) |
| InChIKey | YSILUKUQWCMHMS-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|