C10H13N5O4 — CID 62119046
(E)-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoylamino]-4-oxobut-2-enoic acid (PubChem CID 62119046) has the molecular formula C10H13N5O4 and a molecular weight of 267.25 g/mol. Its IUPAC name is (E)-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoylamino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 62119046 |
| Molecular Formula | C10H13N5O4 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (E)-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoylamino]-4-oxobut-2-enoic acid |
| SMILES | CC(NC(=O)NC(=O)/C=C/C(=O)O)c1nncn1C |
| InChI | InChI=1S/C10H13N5O4/c1-6(9-14-11-5-15(9)2)12-10(19)13-7(16)3-4-8(17)18/h3-6H,1-2H3,(H,17,18)(H2,12,13,16,19)/b4-3+ |
| InChIKey | ILDBMDFHJLSGJH-ONEGZZNKSA-N |
| XLogP | -0.66 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|