C10H17F3N4O — CID 62119200
N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-3-(2,2,2-trifluoroethoxy)propan-1-amine (PubChem CID 62119200) has the molecular formula C10H17F3N4O and a molecular weight of 266.27 g/mol. Its IUPAC name is N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-3-(2,2,2-trifluoroethoxy)propan-1-amine.
| Compound Name | N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-3-(2,2,2-trifluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 62119200 |
| Molecular Formula | C10H17F3N4O |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]-3-(2,2,2-trifluoroethoxy)propan-1-amine |
| SMILES | CC(NCCCOCC(F)(F)F)c1nncn1C |
| InChI | InChI=1S/C10H17F3N4O/c1-8(9-16-15-7-17(9)2)14-4-3-5-18-6-10(11,12)13/h7-8,14H,3-6H2,1-2H3 |
| InChIKey | XKUPVCFCOQQSSM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|