C11H12N6S — CID 62119356
5-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1,3-benzothiazole-4,5-diamine (PubChem CID 62119356) has the molecular formula C11H12N6S and a molecular weight of 260.33 g/mol. Its IUPAC name is 5-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1,3-benzothiazole-4,5-diamine.
| Compound Name | 5-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1,3-benzothiazole-4,5-diamine |
|---|---|
| PubChem CID | 62119356 |
| Molecular Formula | C11H12N6S |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 5-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1,3-benzothiazole-4,5-diamine |
| SMILES | Cn1cnnc1CNc1ccc2scnc2c1N |
| InChI | InChI=1S/C11H12N6S/c1-17-5-15-16-9(17)4-13-7-2-3-8-11(10(7)12)14-6-18-8/h2-3,5-6,13H,4,12H2,1H3 |
| InChIKey | QDDJEJHMHDFVDW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|