C15H25N — CID 62119474
N-[1-(3-methylphenyl)ethyl]hexan-3-amine (PubChem CID 62119474) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is N-[1-(3-methylphenyl)ethyl]hexan-3-amine.
| Compound Name | N-[1-(3-methylphenyl)ethyl]hexan-3-amine |
|---|---|
| PubChem CID | 62119474 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N-[1-(3-methylphenyl)ethyl]hexan-3-amine |
| SMILES | CCCC(CC)NC(C)c1cccc(C)c1 |
| InChI | InChI=1S/C15H25N/c1-5-8-15(6-2)16-13(4)14-10-7-9-12(3)11-14/h7,9-11,13,15-16H,5-6,8H2,1-4H3 |
| InChIKey | YFASUDVUAGYYRL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |