C25H19NO4 — CID 6212113
(4Z)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-2-(2-methylphenyl)isoquinoline-1,3-dione (PubChem CID 6212113) has the molecular formula C25H19NO4 and a molecular weight of 397.43 g/mol. Its IUPAC name is (4Z)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-2-(2-methylphenyl)isoquinoline-1,3-dione.
| Compound Name | (4Z)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-2-(2-methylphenyl)isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 6212113 |
| Molecular Formula | C25H19NO4 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (4Z)-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-2-(2-methylphenyl)isoquinoline-1,3-dione |
| SMILES | Cc1ccccc1N1C(=O)/C(=C\c2ccc3c(c2)OCCO3)c2ccccc2C1=O |
| InChI | InChI=1S/C25H19NO4/c1-16-6-2-5-9-21(16)26-24(27)19-8-4-3-7-18(19)20(25(26)28)14-17-10-11-22-23(15-17)30-13-12-29-22/h2-11,14-15H,12-13H2,1H3/b20-14- |
| InChIKey | HWDXDZCJYCNEGZ-ZHZULCJRSA-N |
| XLogP | 4.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|