C12H15NO3 — CID 62121764
5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)furan-2-carbaldehyde (PubChem CID 62121764) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)furan-2-carbaldehyde.
| Compound Name | 5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 62121764 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(N2CCOC3CCCC32)o1 |
| InChI | InChI=1S/C12H15NO3/c14-8-9-4-5-12(16-9)13-6-7-15-11-3-1-2-10(11)13/h4-5,8,10-11H,1-3,6-7H2 |
| InChIKey | OCQLUPMJOHPOIR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|