About 2-(1-methylimidazo[4,5-c]pyridin-2-yl)quinoline
2-(1-methylimidazo[4,5-c]pyridin-2-yl)quinoline (PubChem CID 621221) has the molecular formula C16H12N4
and a molecular weight of 260.30 g/mol. Its IUPAC name is 2-(1-methylimidazo[4,5-c]pyridin-2-yl)quinoline.
Molecular Properties
| Compound Name | 2-(1-methylimidazo[4,5-c]pyridin-2-yl)quinoline |
| PubChem CID | 621221 |
| Molecular Formula | C16H12N4 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-(1-methylimidazo[4,5-c]pyridin-2-yl)quinoline |
| SMILES | Cn1c(-c2ccc3ccccc3n2)nc2cnccc21 |
| InChI | InChI=1S/C16H12N4/c1-20-15-8-9-17-10-14(15)19-16(20)13-7-6-11-4-2-3-5-12(11)18-13/h2-10H,1H3 |
| InChIKey | RFIMLYLCVQGXCD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1-methylimidazo[4,5-c]pyridin-2-yl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methylimidazo[4,5-c]pyridin-2-yl)quinoline?
The IUPAC name of 2-(1-methylimidazo[4,5-c]pyridin-2-yl)quinoline (CID 621221) is 2-(1-methylimidazo[4,5-c]pyridin-2-yl)quinoline.
What is the SMILES notation for 2-(1-methylimidazo[4,5-c]pyridin-2-yl)quinoline?
The canonical SMILES for 2-(1-methylimidazo[4,5-c]pyridin-2-yl)quinoline is Cn1c(-c2ccc3ccccc3n2)nc2cnccc21.
What is the InChIKey of 2-(1-methylimidazo[4,5-c]pyridin-2-yl)quinoline?
The InChIKey is RFIMLYLCVQGXCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4/c1-20-15-8-9-17-10-14(15)19-16(20)13-7-6-11-4-2-3-5-12(11)18-13/h2-10H,1H3.
What are the key properties of 2-(1-methylimidazo[4,5-c]pyridin-2-yl)quinoline?
2-(1-methylimidazo[4,5-c]pyridin-2-yl)quinoline has a molecular weight of 260.30 g/mol, XLogP of 3.18, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylimidazo[4,5-c]pyridin-2-yl)quinoline is sourced from PubChem (CID 621221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).