2-(2,3-dimethylpiperidin-1-yl)butanoic acid

C11H21NO2 — CID 62122861

IUPAC2-(2,3-dimethylpiperidin-1-yl)butanoic acid
SMILESCCC(C(=O)O)N1CCCC(C)C1C
InChIInChI=1S/C11H21NO2/c1-4-10(11(13)14)12-7-5-6-8(2)9(12)3/h8-10H,4-7H2,1-3H3,(H,13,14)
InChIKeyVPPDLRPPXBUHDF-UHFFFAOYSA-N
MW199.29 g/mol
LogP1.97
Rot. Bonds3

About 2-(2,3-dimethylpiperidin-1-yl)butanoic acid

2-(2,3-dimethylpiperidin-1-yl)butanoic acid (PubChem CID 62122861) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 2-(2,3-dimethylpiperidin-1-yl)butanoic acid.

Molecular Properties

Compound Name2-(2,3-dimethylpiperidin-1-yl)butanoic acid
PubChem CID62122861
Molecular FormulaC11H21NO2
Molecular Weight199.29 g/mol
Exact Mass199.16
IUPAC Name2-(2,3-dimethylpiperidin-1-yl)butanoic acid
SMILESCCC(C(=O)O)N1CCCC(C)C1C
InChIInChI=1S/C11H21NO2/c1-4-10(11(13)14)12-7-5-6-8(2)9(12)3/h8-10H,4-7H2,1-3H3,(H,13,14)
InChIKeyVPPDLRPPXBUHDF-UHFFFAOYSA-N
XLogP1.97
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.29
LogP ≤ 51.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(2,3-dimethylpiperidin-1-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dimethylpiperidin-1-yl)butanoic acid?
The IUPAC name of 2-(2,3-dimethylpiperidin-1-yl)butanoic acid (CID 62122861) is 2-(2,3-dimethylpiperidin-1-yl)butanoic acid.
What is the SMILES notation for 2-(2,3-dimethylpiperidin-1-yl)butanoic acid?
The canonical SMILES for 2-(2,3-dimethylpiperidin-1-yl)butanoic acid is CCC(C(=O)O)N1CCCC(C)C1C.
What is the InChIKey of 2-(2,3-dimethylpiperidin-1-yl)butanoic acid?
The InChIKey is VPPDLRPPXBUHDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-4-10(11(13)14)12-7-5-6-8(2)9(12)3/h8-10H,4-7H2,1-3H3,(H,13,14).
What are the key properties of 2-(2,3-dimethylpiperidin-1-yl)butanoic acid?
2-(2,3-dimethylpiperidin-1-yl)butanoic acid has a molecular weight of 199.29 g/mol, XLogP of 1.97, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethylpiperidin-1-yl)butanoic acid is sourced from PubChem (CID 62122861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).