C15H21NO2S — CID 62123422
(E)-3-[5-[(2,3-dimethylpiperidin-1-yl)methyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 62123422) has the molecular formula C15H21NO2S and a molecular weight of 279.40 g/mol. Its IUPAC name is (E)-3-[5-[(2,3-dimethylpiperidin-1-yl)methyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[(2,3-dimethylpiperidin-1-yl)methyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 62123422 |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (E)-3-[5-[(2,3-dimethylpiperidin-1-yl)methyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | CC1CCCN(Cc2cc(/C=C/C(=O)O)cs2)C1C |
| InChI | InChI=1S/C15H21NO2S/c1-11-4-3-7-16(12(11)2)9-14-8-13(10-19-14)5-6-15(17)18/h5-6,8,10-12H,3-4,7,9H2,1-2H3,(H,17,18)/b6-5+ |
| InChIKey | AUPGREAOZLCSJB-AATRIKPKSA-N |
| XLogP | 3.47 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|