About 4-(chloromethyl)-2-[3-(2,3-dimethylpiperidin-1-yl)propyl]-1,3-thiazole
4-(chloromethyl)-2-[3-(2,3-dimethylpiperidin-1-yl)propyl]-1,3-thiazole (PubChem CID 62123594) has the molecular formula C14H23ClN2S
and a molecular weight of 286.87 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[3-(2,3-dimethylpiperidin-1-yl)propyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 4-(chloromethyl)-2-[3-(2,3-dimethylpiperidin-1-yl)propyl]-1,3-thiazole |
| PubChem CID | 62123594 |
| Molecular Formula | C14H23ClN2S |
| Molecular Weight | 286.87 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 4-(chloromethyl)-2-[3-(2,3-dimethylpiperidin-1-yl)propyl]-1,3-thiazole |
| SMILES | CC1CCCN(CCCc2nc(CCl)cs2)C1C |
| InChI | InChI=1S/C14H23ClN2S/c1-11-5-3-7-17(12(11)2)8-4-6-14-16-13(9-15)10-18-14/h10-12H,3-9H2,1-2H3 |
| InChIKey | FSUSZHVMDSFBFJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.87 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-2-[3-(2,3-dimethylpiperidin-1-yl)propyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-2-[3-(2,3-dimethylpiperidin-1-yl)propyl]-1,3-thiazole?
The IUPAC name of 4-(chloromethyl)-2-[3-(2,3-dimethylpiperidin-1-yl)propyl]-1,3-thiazole (CID 62123594) is 4-(chloromethyl)-2-[3-(2,3-dimethylpiperidin-1-yl)propyl]-1,3-thiazole.
What is the SMILES notation for 4-(chloromethyl)-2-[3-(2,3-dimethylpiperidin-1-yl)propyl]-1,3-thiazole?
The canonical SMILES for 4-(chloromethyl)-2-[3-(2,3-dimethylpiperidin-1-yl)propyl]-1,3-thiazole is CC1CCCN(CCCc2nc(CCl)cs2)C1C.
What is the InChIKey of 4-(chloromethyl)-2-[3-(2,3-dimethylpiperidin-1-yl)propyl]-1,3-thiazole?
The InChIKey is FSUSZHVMDSFBFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23ClN2S/c1-11-5-3-7-17(12(11)2)8-4-6-14-16-13(9-15)10-18-14/h10-12H,3-9H2,1-2H3.
What are the key properties of 4-(chloromethyl)-2-[3-(2,3-dimethylpiperidin-1-yl)propyl]-1,3-thiazole?
4-(chloromethyl)-2-[3-(2,3-dimethylpiperidin-1-yl)propyl]-1,3-thiazole has a molecular weight of 286.87 g/mol, XLogP of 3.93, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-2-[3-(2,3-dimethylpiperidin-1-yl)propyl]-1,3-thiazole is sourced from PubChem (CID 62123594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).