C13H19FN2 — CID 62124073
4-(2,3-dimethylpiperidin-1-yl)-3-fluoroaniline (PubChem CID 62124073) has the molecular formula C13H19FN2 and a molecular weight of 222.31 g/mol. Its IUPAC name is 4-(2,3-dimethylpiperidin-1-yl)-3-fluoroaniline.
| Compound Name | 4-(2,3-dimethylpiperidin-1-yl)-3-fluoroaniline |
|---|---|
| PubChem CID | 62124073 |
| Molecular Formula | C13H19FN2 |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 4-(2,3-dimethylpiperidin-1-yl)-3-fluoroaniline |
| SMILES | CC1CCCN(c2ccc(N)cc2F)C1C |
| InChI | InChI=1S/C13H19FN2/c1-9-4-3-7-16(10(9)2)13-6-5-11(15)8-12(13)14/h5-6,8-10H,3-4,7,15H2,1-2H3 |
| InChIKey | KIAKMLGOEULHCJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|