About 5-(2,3-dimethylpiperidin-1-yl)-1,3-benzothiazol-4-amine
5-(2,3-dimethylpiperidin-1-yl)-1,3-benzothiazol-4-amine (PubChem CID 62124984) has the molecular formula C14H19N3S
and a molecular weight of 261.39 g/mol. Its IUPAC name is 5-(2,3-dimethylpiperidin-1-yl)-1,3-benzothiazol-4-amine.
Molecular Properties
| Compound Name | 5-(2,3-dimethylpiperidin-1-yl)-1,3-benzothiazol-4-amine |
| PubChem CID | 62124984 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 5-(2,3-dimethylpiperidin-1-yl)-1,3-benzothiazol-4-amine |
| SMILES | CC1CCCN(c2ccc3scnc3c2N)C1C |
| InChI | InChI=1S/C14H19N3S/c1-9-4-3-7-17(10(9)2)11-5-6-12-14(13(11)15)16-8-18-12/h5-6,8-10H,3-4,7,15H2,1-2H3 |
| InChIKey | SSUNSWJKNUSXNK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,3-dimethylpiperidin-1-yl)-1,3-benzothiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-dimethylpiperidin-1-yl)-1,3-benzothiazol-4-amine?
The IUPAC name of 5-(2,3-dimethylpiperidin-1-yl)-1,3-benzothiazol-4-amine (CID 62124984) is 5-(2,3-dimethylpiperidin-1-yl)-1,3-benzothiazol-4-amine.
What is the SMILES notation for 5-(2,3-dimethylpiperidin-1-yl)-1,3-benzothiazol-4-amine?
The canonical SMILES for 5-(2,3-dimethylpiperidin-1-yl)-1,3-benzothiazol-4-amine is CC1CCCN(c2ccc3scnc3c2N)C1C.
What is the InChIKey of 5-(2,3-dimethylpiperidin-1-yl)-1,3-benzothiazol-4-amine?
The InChIKey is SSUNSWJKNUSXNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3S/c1-9-4-3-7-17(10(9)2)11-5-6-12-14(13(11)15)16-8-18-12/h5-6,8-10H,3-4,7,15H2,1-2H3.
What are the key properties of 5-(2,3-dimethylpiperidin-1-yl)-1,3-benzothiazol-4-amine?
5-(2,3-dimethylpiperidin-1-yl)-1,3-benzothiazol-4-amine has a molecular weight of 261.39 g/mol, XLogP of 3.50, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dimethylpiperidin-1-yl)-1,3-benzothiazol-4-amine is sourced from PubChem (CID 62124984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).