C15H19BrN2O3 — CID 62125862
4-[[4-(bromomethyl)-2,6-dimethoxyphenoxy]methyl]-1-ethylpyrazole (PubChem CID 62125862) has the molecular formula C15H19BrN2O3 and a molecular weight of 355.23 g/mol. Its IUPAC name is 4-[[4-(bromomethyl)-2,6-dimethoxyphenoxy]methyl]-1-ethylpyrazole.
| Compound Name | 4-[[4-(bromomethyl)-2,6-dimethoxyphenoxy]methyl]-1-ethylpyrazole |
|---|---|
| PubChem CID | 62125862 |
| Molecular Formula | C15H19BrN2O3 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 4-[[4-(bromomethyl)-2,6-dimethoxyphenoxy]methyl]-1-ethylpyrazole |
| SMILES | CCn1cc(COc2c(OC)cc(CBr)cc2OC)cn1 |
| InChI | InChI=1S/C15H19BrN2O3/c1-4-18-9-12(8-17-18)10-21-15-13(19-2)5-11(7-16)6-14(15)20-3/h5-6,8-9H,4,7,10H2,1-3H3 |
| InChIKey | SCTKGBUOPPLFEG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|