C12H12Br3N3 — CID 62126001
2,4,6-tribromo-N-[(1-ethylpyrazol-4-yl)methyl]aniline (PubChem CID 62126001) has the molecular formula C12H12Br3N3 and a molecular weight of 437.96 g/mol. Its IUPAC name is 2,4,6-tribromo-N-[(1-ethylpyrazol-4-yl)methyl]aniline.
| Compound Name | 2,4,6-tribromo-N-[(1-ethylpyrazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 62126001 |
| Molecular Formula | C12H12Br3N3 |
| Molecular Weight | 437.96 g/mol |
| Exact Mass | 434.86 |
| IUPAC Name | 2,4,6-tribromo-N-[(1-ethylpyrazol-4-yl)methyl]aniline |
| SMILES | CCn1cc(CNc2c(Br)cc(Br)cc2Br)cn1 |
| InChI | InChI=1S/C12H12Br3N3/c1-2-18-7-8(6-17-18)5-16-12-10(14)3-9(13)4-11(12)15/h3-4,6-7,16H,2,5H2,1H3 |
| InChIKey | ISKSTZMTHXSHMY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.96 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |