C12H21N3 — CID 62126227
4-methyl-1-[(1-methylpyrazol-4-yl)methyl]cyclohexan-1-amine (PubChem CID 62126227) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 4-methyl-1-[(1-methylpyrazol-4-yl)methyl]cyclohexan-1-amine.
| Compound Name | 4-methyl-1-[(1-methylpyrazol-4-yl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 62126227 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 4-methyl-1-[(1-methylpyrazol-4-yl)methyl]cyclohexan-1-amine |
| SMILES | CC1CCC(N)(Cc2cnn(C)c2)CC1 |
| InChI | InChI=1S/C12H21N3/c1-10-3-5-12(13,6-4-10)7-11-8-14-15(2)9-11/h8-10H,3-7,13H2,1-2H3 |
| InChIKey | CVZDEEOMKFSFKI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |