C9H12BrF3N2O — CID 62128422
4-bromo-3,5-dimethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole (PubChem CID 62128422) has the molecular formula C9H12BrF3N2O and a molecular weight of 301.11 g/mol. Its IUPAC name is 4-bromo-3,5-dimethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole.
| Compound Name | 4-bromo-3,5-dimethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole |
|---|---|
| PubChem CID | 62128422 |
| Molecular Formula | C9H12BrF3N2O |
| Molecular Weight | 301.11 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 4-bromo-3,5-dimethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole |
| SMILES | Cc1nn(CCOCC(F)(F)F)c(C)c1Br |
| InChI | InChI=1S/C9H12BrF3N2O/c1-6-8(10)7(2)15(14-6)3-4-16-5-9(11,12)13/h3-5H2,1-2H3 |
| InChIKey | WYYYDCQYRMVNSZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.11 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|