About 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-4,4-dimethylpentan-2-amine
3-(4-chloro-3,5-dimethylpyrazol-1-yl)-4,4-dimethylpentan-2-amine (PubChem CID 62128486) has the molecular formula C12H22ClN3
and a molecular weight of 243.78 g/mol. Its IUPAC name is 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-4,4-dimethylpentan-2-amine.
Molecular Properties
| Compound Name | 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-4,4-dimethylpentan-2-amine |
| PubChem CID | 62128486 |
| Molecular Formula | C12H22ClN3 |
| Molecular Weight | 243.78 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-4,4-dimethylpentan-2-amine |
| SMILES | Cc1nn(C(C(C)N)C(C)(C)C)c(C)c1Cl |
| InChI | InChI=1S/C12H22ClN3/c1-7(14)11(12(4,5)6)16-9(3)10(13)8(2)15-16/h7,11H,14H2,1-6H3 |
| InChIKey | WHJBSSKFQXWXMQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.78 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-4,4-dimethylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-4,4-dimethylpentan-2-amine?
The IUPAC name of 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-4,4-dimethylpentan-2-amine (CID 62128486) is 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-4,4-dimethylpentan-2-amine.
What is the SMILES notation for 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-4,4-dimethylpentan-2-amine?
The canonical SMILES for 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-4,4-dimethylpentan-2-amine is Cc1nn(C(C(C)N)C(C)(C)C)c(C)c1Cl.
What is the InChIKey of 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-4,4-dimethylpentan-2-amine?
The InChIKey is WHJBSSKFQXWXMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22ClN3/c1-7(14)11(12(4,5)6)16-9(3)10(13)8(2)15-16/h7,11H,14H2,1-6H3.
What are the key properties of 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-4,4-dimethylpentan-2-amine?
3-(4-chloro-3,5-dimethylpyrazol-1-yl)-4,4-dimethylpentan-2-amine has a molecular weight of 243.78 g/mol, XLogP of 3.09, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chloro-3,5-dimethylpyrazol-1-yl)-4,4-dimethylpentan-2-amine is sourced from PubChem (CID 62128486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).