About 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxy]pyridin-3-amine
6-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxy]pyridin-3-amine (PubChem CID 62128808) has the molecular formula C14H19ClN4O
and a molecular weight of 294.79 g/mol. Its IUPAC name is 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxy]pyridin-3-amine.
Molecular Properties
| Compound Name | 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxy]pyridin-3-amine |
| PubChem CID | 62128808 |
| Molecular Formula | C14H19ClN4O |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxy]pyridin-3-amine |
| SMILES | Cc1nn(-c2ccc(N)c(OC(C)(C)C)n2)c(C)c1Cl |
| InChI | InChI=1S/C14H19ClN4O/c1-8-12(15)9(2)19(18-8)11-7-6-10(16)13(17-11)20-14(3,4)5/h6-7H,16H2,1-5H3 |
| InChIKey | IXFOPAIMAVSSJI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxy]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxy]pyridin-3-amine?
The IUPAC name of 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxy]pyridin-3-amine (CID 62128808) is 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxy]pyridin-3-amine.
What is the SMILES notation for 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxy]pyridin-3-amine?
The canonical SMILES for 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxy]pyridin-3-amine is Cc1nn(-c2ccc(N)c(OC(C)(C)C)n2)c(C)c1Cl.
What is the InChIKey of 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxy]pyridin-3-amine?
The InChIKey is IXFOPAIMAVSSJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClN4O/c1-8-12(15)9(2)19(18-8)11-7-6-10(16)13(17-11)20-14(3,4)5/h6-7H,16H2,1-5H3.
What are the key properties of 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxy]pyridin-3-amine?
6-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxy]pyridin-3-amine has a molecular weight of 294.79 g/mol, XLogP of 3.30, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chloro-3,5-dimethylpyrazol-1-yl)-2-[(2-methylpropan-2-yl)oxy]pyridin-3-amine is sourced from PubChem (CID 62128808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).